2,4(1H,3H)-Pyrimidinedione,6-methyl-5-(1-piperidinylmethyl)- structure
|
Common Name | 2,4(1H,3H)-Pyrimidinedione,6-methyl-5-(1-piperidinylmethyl)- | ||
|---|---|---|---|---|
| CAS Number | 23213-34-5 | Molecular Weight | 223.27200 | |
| Density | 1.163g/cm3 | Boiling Point | 446.3ºC at 760mmHg | |
| Molecular Formula | C11H17N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.7ºC | |
| Name | 6-methyl-5-(piperidin-1-ylmethyl)-1H-pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.163g/cm3 |
|---|---|
| Boiling Point | 446.3ºC at 760mmHg |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.27200 |
| Flash Point | 223.7ºC |
| Exact Mass | 223.13200 |
| PSA | 68.96000 |
| LogP | 0.29540 |
| Vapour Pressure | 1.4E-08mmHg at 25°C |
| Index of Refraction | 1.527 |
| InChIKey | WSTDDOLPOMWNCC-UHFFFAOYSA-N |
| SMILES | Cc1[nH]c(=O)[nH]c(=O)c1CN1CCCCC1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-methyl-5-piperidin-1-ylmethyl-1H-pyrimidine-2,4-dione |
| 6-Methyl-5-(1-piperidinylmethyl)-2,4-pyrimidinediol |
| 6-methyl-5-(1-piperidinylmethyl)-2,4(1H,3H)-pyrimidinedione |
| 6-METHYL-5-(PIPERIDIN-1-YLMETHYL)-2,4-PYRIMIDINEDIOL |
| 6-methyl-5-(piperidin-1-ylmethyl)pyrimidine-2,4-diol |