2,4,5-trichlorophenyl p-methoxybenzyl carbonate structure
|
Common Name | 2,4,5-trichlorophenyl p-methoxybenzyl carbonate | ||
|---|---|---|---|---|
| CAS Number | 23218-62-4 | Molecular Weight | 361.60400 | |
| Density | 1.423g/cm3 | Boiling Point | 475.4ºC at 760 mmHg | |
| Molecular Formula | C15H11Cl3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.7ºC | |
| Name | (4-methoxyphenyl)methyl (2,4,5-trichlorophenyl) carbonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.423g/cm3 |
|---|---|
| Boiling Point | 475.4ºC at 760 mmHg |
| Molecular Formula | C15H11Cl3O4 |
| Molecular Weight | 361.60400 |
| Flash Point | 185.7ºC |
| Exact Mass | 359.97200 |
| PSA | 44.76000 |
| LogP | 5.37100 |
| Vapour Pressure | 3.32E-09mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | UDCSECKCIHHFRO-UHFFFAOYSA-N |
| SMILES | COc1ccc(COC(=O)Oc2cc(Cl)c(Cl)cc2Cl)cc1 |
| HS Code | 2920909090 |
|---|
|
~%
2,4,5-trichloro... CAS#:23218-62-4 |
| Literature: Yajima,H. et al. Chemical and Pharmaceutical Bulletin, 1970 , vol. 18, # 12 p. 2574 - 2576 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| p-Methoxybenzyl-2,4,5-trichlorphenylcarbonat |
| EINECS 245-499-8 |
| 4-methoxybenzyl 2,4,5-trichlorophenyl carbonate |
| 2,4,5-trichlorophenyl p-methoxybenzyl carbonate |