3-[(2-ethoxy-2-oxoethyl)amino]benzoic acid structure
|
Common Name | 3-[(2-ethoxy-2-oxoethyl)amino]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 23218-94-2 | Molecular Weight | 223.22500 | |
| Density | 1.279g/cm3 | Boiling Point | 399ºC at 760 mmHg | |
| Molecular Formula | C11H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.1ºC | |
| Name | 3-[(2-ethoxy-2-oxoethyl)amino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.279g/cm3 |
|---|---|
| Boiling Point | 399ºC at 760 mmHg |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.22500 |
| Flash Point | 195.1ºC |
| Exact Mass | 223.08400 |
| PSA | 75.63000 |
| LogP | 1.43280 |
| Vapour Pressure | 4.39E-07mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | RBDOGNPBVBDZHY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CNc1cccc(C(=O)O)c1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| HMS1582L19 |
| N-<3-Carboxy-phenyl>-glycinaethylester |