3-[(2-methoxy-2-oxoethyl)amino]benzoic acid()
Modify Date: 2025-10-21 01:30:11
![3-[(2-methoxy-2-oxoethyl)amino]benzoic acid() Structure](https://image.chemsrc.com/caspic/471/418788-94-0.png)
3-[(2-methoxy-2-oxoethyl)amino]benzoic acid() structure
|
Common Name | 3-[(2-methoxy-2-oxoethyl)amino]benzoic acid() | ||
|---|---|---|---|---|
| CAS Number | 418788-94-0 | Molecular Weight | 209.19900 | |
| Density | 1.324g/cm3 | Boiling Point | 390.1ºC at 760 mmHg | |
| Molecular Formula | C10H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.7ºC | |
| Name | 3-[(2-methoxy-2-oxoethyl)amino]benzoic acid() |
|---|
| Density | 1.324g/cm3 |
|---|---|
| Boiling Point | 390.1ºC at 760 mmHg |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.19900 |
| Flash Point | 189.7ºC |
| Exact Mass | 209.06900 |
| PSA | 75.63000 |
| LogP | 1.04270 |
| Index of Refraction | 1.597 |
| InChIKey | KVBJHWFMJDMCDY-UHFFFAOYSA-N |
| SMILES | COC(=O)CNc1cccc(C(=O)O)c1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |