(2-Nitro-1,4-phenylene)dimethanol structure
|
Common Name | (2-Nitro-1,4-phenylene)dimethanol | ||
|---|---|---|---|---|
| CAS Number | 23222-97-1 | Molecular Weight | 183.161 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 398.1±32.0 °C at 760 mmHg | |
| Molecular Formula | C8H9NO4 | Melting Point | 95ºC | |
| MSDS | N/A | Flash Point | 180.2±13.6 °C | |
Use of (2-Nitro-1,4-phenylene)dimethanol |
| Name | [4-(hydroxymethyl)-3-nitrophenyl]methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 398.1±32.0 °C at 760 mmHg |
| Melting Point | 95ºC |
| Molecular Formula | C8H9NO4 |
| Molecular Weight | 183.161 |
| Flash Point | 180.2±13.6 °C |
| Exact Mass | 183.053162 |
| PSA | 86.28000 |
| LogP | -0.42 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.627 |
| InChIKey | KWVHOBYJXDKIPL-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(CO)ccc1CO |
| HS Code | 2906299090 |
|---|
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 1,4-benzenedimethanol,2-nitro |
| 2-Nitro-p-xylylene Glycol |
| 1,4-Benzenedimethanol, 2-nitro- |
| (2-Nitro-1,4-phenylene)dimethanol |
| EINECS 245-503-8 |