2-Nitro-1,4-benzenediamine structure
|
Common Name | 2-Nitro-1,4-benzenediamine | ||
|---|---|---|---|---|
| CAS Number | 5307-14-2 | Molecular Weight | 153.139 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 385.4±22.0 °C at 760 mmHg | |
| Molecular Formula | C6H7N3O2 | Melting Point | 135-138 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 186.9±22.3 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-nitro-p-phenylenediamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 385.4±22.0 °C at 760 mmHg |
| Melting Point | 135-138 °C(lit.) |
| Molecular Formula | C6H7N3O2 |
| Molecular Weight | 153.139 |
| Flash Point | 186.9±22.3 °C |
| Exact Mass | 153.053833 |
| PSA | 97.86000 |
| LogP | 0.91 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.708 |
| InChIKey | HVHNMNGARPCGGD-UHFFFAOYSA-N |
| SMILES | Nc1ccc(N)c([N+](=O)[O-])c1 |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility | <0.1 g/100 mL at 22 ºC |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H317 |
| Precautionary Statements | P280 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn:Harmful |
| Risk Phrases | R68 |
| Safety Phrases | S36/37-S45 |
| RIDADR | 3143 |
| WGK Germany | 2 |
| RTECS | ST3000000 |
| Packaging Group | I; II; III |
| Hazard Class | 6.1 |
| HS Code | 29215119 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2921519090 |
|---|---|
| Summary | 2921519090. o-, m-, p-phenylenediamine, diaminotoluenes, and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:17.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Teratogenic evaluation of 2-nitro-p-phenylenediamine, 4-nitro-o-phenylenediamine, and 2,5-toluenediamine sulfate in the mouse.
Teratology 24(3) , 253-65, (1981) Pregnant outbred albino (CD-1) mice were given 2-nitro-p-phenylenediamine (2NPPD; 32-256 mg/kg/day), 4-nitro-o-phenylenediamine (4NOPD; 16-1024 mg/kg/day) or 2,5-toluenediamine sulfate (2,5TDS; 16-64 ... |
|
|
Metabolism of the hair dye component, nitro-p-phenylenediamine, in the rat.
Chem. Pharm. Bull. 35(2) , 785-91, (1987)
|
|
|
Regioselective N-acetylation as a route of nitro-9-phenylenediamine metabolism by rat liver cytosol.
Chem. Pharm. Bull. 38(9) , 2561-6, (1990) Regioselectivity in N-acetylation of nitro-0-phenylenediamine, a widely used hair dye component, by rat liver cytosolic N-acetyltransferases was studied in relation to its substituent effects on enzym... |
| 2-NPPD |
| 2-Nitro-p-phenylenediamine |
| 2-Nitro-1,4-phenylenediaMine |
| dyegs |
| 2-nitrobenzene-1,4-diamine |
| 2NDB |
| 1,4-Diamino-2-nitrobenzene |
| 2,5-diamino-nitrobenzene |
| 2-N-p-PDA |
| 1,4-diamino-nitrobenzene |
| 2-nitro-1,4-diamino-benzene |
| MFCD00007903 |
| 2-Nitro-1,4-benzenediamine |
| 1,4-Benzenediamine, 2-nitro- |
| NITRO-PPD |
| Rodol 2R |
| EINECS 226-164-5 |