3-bromo-1,1,1-trichloro-3-nitropropan-2-ol structure
|
Common Name | 3-bromo-1,1,1-trichloro-3-nitropropan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 23279-12-1 | Molecular Weight | 287.32400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C3H3BrCl3NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-bromo-1,1,1-trichloro-3-nitropropan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C3H3BrCl3NO3 |
|---|---|
| Molecular Weight | 287.32400 |
| Exact Mass | 284.83600 |
| PSA | 66.05000 |
| LogP | 2.23840 |
| InChIKey | XSSZFKZNAPYLIR-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])C(Br)C(O)C(Cl)(Cl)Cl |
|
~%
3-bromo-1,1,1-t... CAS#:23279-12-1 |
| Literature: Eckstein,Z. et al. Journal of the Chemical Society, 1961 , p. 1370 - 1375 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,1,1-Trichlor-3-brom-3-nitro-propanol-2 |
| 3-bromo-1,1,1-trichloro-3-nitro-propan-2-ol |
| 1-Brom-3,3,3-trichlor-1-nitro-propan-2-ol |
| 2-Propanol,3-bromo-1,1,1-trichloro-3-nitro |
| 1-Brom-1-nitro-3,3,3-trichlor-2-propanol |
| 1-bromo-3,3,3-trichloro-1-nitro-propan-2-ol |