(1,1,1-trichloro-3-nitro-propan-2-yl) acetate structure
|
Common Name | (1,1,1-trichloro-3-nitro-propan-2-yl) acetate | ||
|---|---|---|---|---|
| CAS Number | 761-07-9 | Molecular Weight | 250.46400 | |
| Density | 1.546g/cm3 | Boiling Point | 297.2ºC at 760 mmHg | |
| Molecular Formula | C5H6Cl3NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 133.6ºC | |
| Name | (1,1,1-trichloro-3-nitropropan-2-yl) acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.546g/cm3 |
|---|---|
| Boiling Point | 297.2ºC at 760 mmHg |
| Molecular Formula | C5H6Cl3NO4 |
| Molecular Weight | 250.46400 |
| Flash Point | 133.6ºC |
| Exact Mass | 248.93600 |
| PSA | 72.12000 |
| LogP | 2.08820 |
| Index of Refraction | 1.498 |
| InChIKey | IZCQFYTXKWWSMP-UHFFFAOYSA-N |
| SMILES | CC(=O)OC(C[N+](=O)[O-])C(Cl)(Cl)Cl |
|
~%
(1,1,1-trichlor... CAS#:761-07-9 |
| Literature: Brower; Burkett Journal of the American Chemical Society, 1953 , vol. 75, p. 1082 |
|
~%
(1,1,1-trichlor... CAS#:761-07-9 |
| Literature: Chattaway; Witherington Journal of the Chemical Society, 1935 , p. 1179 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-acetoxy-1,1,1-trichloro-3-nitro-propane |
| 2-Acetoxy-1,1,1-trichlor-3-nitropropan |
| 1-Trichlor-2-acetoxy-3-nitropropan |