Cyclohexanol,1-ethynyl-, 1-benzoate
Modify Date: 2026-07-07 13:21:04
Cyclohexanol,1-ethynyl-, 1-benzoate structure
|
Common Name | Cyclohexanol,1-ethynyl-, 1-benzoate | ||
|---|---|---|---|---|
| CAS Number | 23293-77-8 | Molecular Weight | 228.28600 | |
| Density | 1.09g/cm3 | Boiling Point | 313.7ºC at 760 mmHg | |
| Molecular Formula | C15H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 128.7ºC | |
| Name | (1-ethynylcyclohexyl) benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.09g/cm3 |
|---|---|
| Boiling Point | 313.7ºC at 760 mmHg |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.28600 |
| Flash Point | 128.7ºC |
| Exact Mass | 228.11500 |
| PSA | 26.30000 |
| LogP | 3.17950 |
| Vapour Pressure | 0.000488mmHg at 25°C |
| Index of Refraction | 1.548 |
| InChIKey | PSCIBDKASFWWDB-UHFFFAOYSA-N |
| SMILES | C#CC1(OC(=O)c2ccccc2)CCCCC1 |
|
~%
Cyclohexanol,1-... CAS#:23293-77-8 |
| Literature: Trahanovsky,W.S.; Emeis,S.L. Journal of the American Chemical Society, 1975 , vol. 97, p. 3773 - 3777 |
|
~%
Cyclohexanol,1-... CAS#:23293-77-8 |
| Literature: Klosa Angewandte Chemie, 1957 , vol. 69, p. 135 |
CAS#:931-49-7| Cyclohexanol,1-ethynyl-,1-benzoate |
| 1-ethynylcyclohexyl benzoate |
| 1-Ethinyl-cyclohexanol-benzoat |