Benzoic acid,2-bromo-3,4,5-trimethoxy- structure
|
Common Name | Benzoic acid,2-bromo-3,4,5-trimethoxy- | ||
|---|---|---|---|---|
| CAS Number | 23346-82-9 | Molecular Weight | 291.09500 | |
| Density | 1.53g/cm3 | Boiling Point | 360.2ºC at 760mmHg | |
| Molecular Formula | C10H11BrO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.7ºC | |
| Name | 2-bromo-3,4,5-trimethoxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.53g/cm3 |
|---|---|
| Boiling Point | 360.2ºC at 760mmHg |
| Molecular Formula | C10H11BrO5 |
| Molecular Weight | 291.09500 |
| Flash Point | 171.7ºC |
| Exact Mass | 289.97900 |
| PSA | 64.99000 |
| LogP | 2.17310 |
| Vapour Pressure | 8.11E-06mmHg at 25°C |
| Index of Refraction | 1.553 |
| InChIKey | AUVPVHYYPCTFAV-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)O)c(Br)c(OC)c1OC |
| HS Code | 2918990090 |
|---|
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Bromo-3,4,5-trimethoxy-benzoic acid |
| Bromgallussaeuretrimethylaether |
| 3,4,5-Trimethoxy-2-brom-benzoesaeure |
| 2-Brom-3,4,5-trimethoxy-benzoesaeure |