2,5-BIS(DIMETHYLSILYL)THIOPHENE structure
|
Common Name | 2,5-BIS(DIMETHYLSILYL)THIOPHENE | ||
|---|---|---|---|---|
| CAS Number | 23395-60-0 | Molecular Weight | 200.44900 | |
| Density | 0.93 g/mL at 25ºC(lit.) | Boiling Point | N/A | |
| Molecular Formula | C8H16SSi2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 126 °F | |
| Symbol |
GHS02 |
Signal Word | Warning | |
| Name | [5-(dimethyl-λ3-silanyl)thiophen-2-yl]-dimethylsilicon |
|---|---|
| Synonym | More Synonyms |
| Density | 0.93 g/mL at 25ºC(lit.) |
|---|---|
| Molecular Formula | C8H16SSi2 |
| Molecular Weight | 200.44900 |
| Flash Point | 126 °F |
| Exact Mass | 200.05100 |
| PSA | 28.24000 |
| LogP | 1.13550 |
| Index of Refraction | n20/D 1.505(lit.) |
| InChIKey | XTXIDGZUZHAOTE-UHFFFAOYSA-N |
| SMILES | C[Si](C)c1ccc([Si](C)C)s1 |
| Symbol |
GHS02 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H226 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Risk Phrases | R10 |
| Safety Phrases | 16 |
| RIDADR | UN 1993 3 |
| HS Code | 2934999090 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Electrochemical preparation of polythiophene via 2, 5-bis (trimethylsilyl) thiophene. Masuda H, et al.
J. Polym. Sci. A Polym. Chem. 30(8) , 1667-1673, (1992)
|
| MFCD03093971 |
| 2,5-Bis(dimethylsilyl)thiophene |
| Si,Si,Si',Si'-tetramethyl-Si,Si'-thiophene-2,5-diyl-bis-silane |