Methyl 3-Chloro-4-piperazinobenzoate structure
|
Common Name | Methyl 3-Chloro-4-piperazinobenzoate | ||
|---|---|---|---|---|
| CAS Number | 234082-16-7 | Molecular Weight | 254.71300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Methyl 3-chloro-4-(1-piperazinyl)benzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H15ClN2O2 |
|---|---|
| Molecular Weight | 254.71300 |
| Exact Mass | 254.08200 |
| PSA | 41.57000 |
| LogP | 1.93000 |
| InChIKey | YXNWWDUBAHLVBO-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(N2CCNCC2)c(Cl)c1 |
| HS Code | 2933599090 |
|---|
|
~59%
Methyl 3-Chloro... CAS#:234082-16-7 |
| Literature: Kubota, Dai; Ishikawa, Minoru; Yamamoto, Mikio; Murakami, Shoichi; Hachisu, Mitsugu; Katano, Kiyoaki; Ajito, Keiichi Bioorganic and Medicinal Chemistry, 2006 , vol. 14, # 7 p. 2089 - 2108 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| methyl 2-chloroformylacetate |
| methoxycarbonylacetyl chloride |
| Methyl Malonyl chloride 25GR |
| METHYL CHLOROFORMYLACETATE |
| Mehtyl Malonyl Chloride |
| methyl chlorocarbonyl acetate |
| METHYL 3-CHLORO-3-OXOPROPIONATE |
| methyl-3-chlorooxopropionate |
| 3-methoxy-3-oxopropanoyl chloride |