3-butyl-2-[(3-butyl-4-methyl-1H-pyrrol-2-yl)-(4-nitrophenyl)methyl]-4-methyl-1H-pyrrole structure
|
Common Name | 3-butyl-2-[(3-butyl-4-methyl-1H-pyrrol-2-yl)-(4-nitrophenyl)methyl]-4-methyl-1H-pyrrole | ||
|---|---|---|---|---|
| CAS Number | 234440-54-1 | Molecular Weight | 407.54800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H33N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-butyl-2-[(3-butyl-4-methyl-1H-pyrrol-2-yl)-(4-nitrophenyl)methyl]-4-methyl-1H-pyrrole |
|---|
| Molecular Formula | C25H33N3O2 |
|---|---|
| Molecular Weight | 407.54800 |
| Exact Mass | 407.25700 |
| PSA | 77.40000 |
| LogP | 7.25640 |
| InChIKey | DIHQMHFWVDUFQH-UHFFFAOYSA-N |
| SMILES | CCCCc1c(C)c[nH]c1C(c1ccc([N+](=O)[O-])cc1)c1[nH]cc(C)c1CCCC |
|
~82%
3-butyl-2-[(3-b... CAS#:234440-54-1 |
| Literature: Mamardashvili; Zdanovich; Golubchikov Russian Journal of Organic Chemistry, 1998 , vol. 34, # 8 p. 1180 - 1185 |
|
~%
3-butyl-2-[(3-b... CAS#:234440-54-1 |
| Literature: Mamardashvili; Zdanovich; Golubchikov Russian Journal of Organic Chemistry, 1998 , vol. 34, # 8 p. 1180 - 1185 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |