2-(4-Bromophenyl)-4,6-diphenyl-1,3,5-triazine structure
|
Common Name | 2-(4-Bromophenyl)-4,6-diphenyl-1,3,5-triazine | ||
|---|---|---|---|---|
| CAS Number | 23449-08-3 | Molecular Weight | 388.260 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 573.9±52.0 °C at 760 mmHg | |
| Molecular Formula | C21H14BrN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 300.9±30.7 °C | |
| Name | 2-(4-Bromophenyl)-4,6-diphenyl-1,3,5-triazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 573.9±52.0 °C at 760 mmHg |
| Molecular Formula | C21H14BrN3 |
| Molecular Weight | 388.260 |
| Flash Point | 300.9±30.7 °C |
| Exact Mass | 387.037109 |
| PSA | 38.67000 |
| LogP | 6.48 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.646 |
| InChIKey | AYHGAQGOMUQMTR-UHFFFAOYSA-N |
| SMILES | Brc1ccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933699090 |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 2-(4-Bromphenyl)-4,6-diphenyl-symm.-triazin |
| 1,3,5-Triazine, 2-(4-bromophenyl)-4,6-diphenyl- |
| 2-(4-Bromophenyl)-4,6-diphenyl-1,3,5-triazine |
| 2-(4-Bromo-phenyl)-4,6-diphenyl-[1,3,5]triazine |