Benzoic acid,3,6-dimethyl-2-(2,4,6-trimethylbenzoyl) structure
|
Common Name | Benzoic acid,3,6-dimethyl-2-(2,4,6-trimethylbenzoyl) | ||
|---|---|---|---|---|
| CAS Number | 2346-69-2 | Molecular Weight | 296.36000 | |
| Density | 1.133g/cm3 | Boiling Point | 442.2ºC at 760 mmHg | |
| Molecular Formula | C19H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.4ºC | |
| Name | 3,6-dimethyl-2-(2,4,6-trimethylbenzoyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.133g/cm3 |
|---|---|
| Boiling Point | 442.2ºC at 760 mmHg |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.36000 |
| Flash Point | 235.4ºC |
| Exact Mass | 296.14100 |
| PSA | 54.37000 |
| LogP | 4.15780 |
| Vapour Pressure | 1.34E-08mmHg at 25°C |
| Index of Refraction | 1.58 |
| InChIKey | XEJDKLQSXXCIEX-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(C(=O)c2c(C)ccc(C)c2C(=O)O)c(C)c1 |
|
~%
Benzoic acid,3,... CAS#:2346-69-2 |
| Literature: Newman; Lord Journal of the American Chemical Society, 1944 , vol. 66, p. 733 |
|
~%
Benzoic acid,3,... CAS#:2346-69-2 |
| Literature: Newman; Lord Journal of the American Chemical Society, 1944 , vol. 66, p. 733 |
| 2-Mesitylcarbonyl-3.6-dimethyl-benzoesaeure |