9H-Xanthen-9-one,4-chloro-3,8-dihydroxy-6-methoxy-1-methyl- structure
|
Common Name | 9H-Xanthen-9-one,4-chloro-3,8-dihydroxy-6-methoxy-1-methyl- | ||
|---|---|---|---|---|
| CAS Number | 23460-01-7 | Molecular Weight | 306.69800 | |
| Density | 1.513g/cm3 | Boiling Point | 552.3ºC at 760 mmHg | |
| Molecular Formula | C15H11ClO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 287.8ºC | |
| Name | 4-chloro-3,8-dihydroxy-6-methoxy-1-methylxanthen-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.513g/cm3 |
|---|---|
| Boiling Point | 552.3ºC at 760 mmHg |
| Molecular Formula | C15H11ClO5 |
| Molecular Weight | 306.69800 |
| Flash Point | 287.8ºC |
| Exact Mass | 306.03000 |
| PSA | 79.90000 |
| LogP | 3.32780 |
| Vapour Pressure | 8.33E-13mmHg at 25°C |
| Index of Refraction | 1.669 |
| InChIKey | CCCPQTCGPQONAG-UHFFFAOYSA-N |
| SMILES | COc1cc(O)c2c(=O)c3c(C)cc(O)c(Cl)c3oc2c1 |
| HS Code | 2932999099 |
|---|
|
~%
9H-Xanthen-9-on... CAS#:23460-01-7 |
| Literature: Fitzpatrick, Leigh; Sala, Tony; Sargent, Melvyn V. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1980 , p. 85 - 89 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-chloro-3-methoxy-8-methyl-1,6-dihydroxy-xanthone |
| 9H-Xanthen-9-one,4-chloro-3,8-dihydroxy-6-methoxy-1-methyl |
| XANTHONE 2 |
| 4-chloro-3,8-dihydroxy-6-methoxy-1-methyl-xanthen-9-one |
| 5-chloro-1,6-dihydroxy-3-methoxy-8-methylxanthone |