Benzeneacetamide, N-(3-hydroxyphenyl)- structure
|
Common Name | Benzeneacetamide, N-(3-hydroxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 23478-26-4 | Molecular Weight | 227.25900 | |
| Density | 1.251g/cm3 | Boiling Point | 483.2ºC at 760mmHg | |
| Molecular Formula | C14H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246ºC | |
| Name | N-(3-hydroxyphenyl)-2-phenylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.251g/cm3 |
|---|---|
| Boiling Point | 483.2ºC at 760mmHg |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.25900 |
| Flash Point | 246ºC |
| Exact Mass | 227.09500 |
| PSA | 49.33000 |
| LogP | 2.64640 |
| Vapour Pressure | 5.82E-10mmHg at 25°C |
| Index of Refraction | 1.657 |
| InChIKey | NOOCNVIYWCFDCM-UHFFFAOYSA-N |
| SMILES | O=C(Cc1ccccc1)Nc1cccc(O)c1 |
|
~%
Benzeneacetamid... CAS#:23478-26-4 |
| Literature: Sun, Aiming; Prussia, Andrew; Zhan, Weiqiang; Murray, Ernest E.; Doyle, Joshua; Cheng, Li-Ting; Yoon, Jeong-Joong; Radchenko, Eugene V.; Palyulin, Vladimir A.; Compans, Richard W.; Liotta, Dennis C.; Plemper, Richard K.; Snyder, James P. Journal of Medicinal Chemistry, 2006 , vol. 49, # 17 p. 5080 - 5092 |
|
~%
Benzeneacetamid... CAS#:23478-26-4 |
| Literature: Monsanto Company Patent: US3979202 A1, 1976 ; |
| AS-114 |
| 3'-hydroxy-2-phenylacetanilide |
| 3'-Hydroxy-2-phenyl-acetanilid |