(5E)-3-benzyl-5-[(4-chlorophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one structure
|
Common Name | (5E)-3-benzyl-5-[(4-chlorophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 23509-49-1 | Molecular Weight | 345.86600 | |
| Density | 1.44g/cm3 | Boiling Point | 501ºC at 760 mmHg | |
| Molecular Formula | C17H12ClNOS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256.8ºC | |
| Name | (5E)-3-benzyl-5-[(4-chlorophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 501ºC at 760 mmHg |
| Molecular Formula | C17H12ClNOS2 |
| Molecular Weight | 345.86600 |
| Flash Point | 256.8ºC |
| Exact Mass | 345.00500 |
| PSA | 77.70000 |
| LogP | 4.67930 |
| Vapour Pressure | 3.62E-10mmHg at 25°C |
| Index of Refraction | 1.733 |
| InChIKey | SXKLQIXSAPAAII-GDNBJRDFSA-N |
| SMILES | O=C1C(=Cc2ccc(Cl)cc2)SC(=S)N1Cc1ccccc1 |
|
~73%
(5E)-3-benzyl-5... CAS#:23509-49-1 |
| Literature: Khan, Mukhtar Hussain; Haque, Raziul; Safi, Ahmad; Nizamuddin Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1998 , vol. 37, # 10 p. 1069 - 1074 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |