(2-TRIFLUOROMETHYLPHENOXY)ACETONITRILE structure
|
Common Name | (2-TRIFLUOROMETHYLPHENOXY)ACETONITRILE | ||
|---|---|---|---|---|
| CAS Number | 2352-40-1 | Molecular Weight | 206.19800 | |
| Density | 1.24g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-hydroxyimino-3-oxo-N-phenylbutanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.19800 |
| Exact Mass | 206.06900 |
| PSA | 78.76000 |
| LogP | 1.11730 |
| Index of Refraction | 1.573 |
| InChIKey | HMVFHMLPFAZHEW-UHFFFAOYSA-N |
| SMILES | CC(O)=C(N=O)C(=O)Nc1ccccc1 |
| HS Code | 2928000090 |
|---|
|
~87%
(2-TRIFLUOROMET... CAS#:2352-40-1 |
| Literature: Mloston, Grzegorz; Jasinski, Marcin Collection of Czechoslovak Chemical Communications, 2010 , vol. 75, # 8 p. 871 - 885 |
|
~%
(2-TRIFLUOROMET... CAS#:2352-40-1 |
| Literature: European Journal of Organic Chemistry, , # 13 p. 2542 - 2547 |
|
~%
(2-TRIFLUOROMET... CAS#:2352-40-1 |
| Literature: Justus Liebigs Annalen der Chemie, , vol. 236, p. 70 Anm. Justus Liebigs Annalen der Chemie, , vol. 245, p. 357,368 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-Hydroxyimino-acetessigsaeure-anilid |
| 2,3-dioxobutyranilide-2-oxime |
| HMS2506D20 |
| 2-hydroxyimino-3-oxo-N-phenylbutyramide |
| 2-hydroxyimino-3-oxo-butyric acid anilide |
| 2-Hydroxyimino-3-oxo-buttersaeure-anilid |
| N1-phenyl-2-hydroxyimino-3-oxobutanamide |
| 2-Hydroxyimino-3-oxo-butansaeureanilid |
| 2-hydroximinoacetoacetic acid anilide |
| 2-(hydroxyimino)-3-oxo-N-phenylbutanamide |