7-bromo-5-nitroquinolin-8-ol structure
|
Common Name | 7-bromo-5-nitroquinolin-8-ol | ||
|---|---|---|---|---|
| CAS Number | 23521-17-7 | Molecular Weight | 269.05200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H5BrN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-bromo-5-nitroquinolin-8-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H5BrN2O3 |
|---|---|
| Molecular Weight | 269.05200 |
| Exact Mass | 267.94800 |
| PSA | 78.94000 |
| LogP | 3.13430 |
| InChIKey | ZHAQCRBRMYTJHJ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Br)c(O)c2ncccc12 |
|
~87%
7-bromo-5-nitro... CAS#:23521-17-7 |
| Literature: Boger, Dale L.; Duff, Steven R.; Panek, James S.; Yasuda, Masami Journal of Organic Chemistry, 1985 , vol. 50, # 26 p. 5782 - 5789 |
|
~%
7-bromo-5-nitro... CAS#:23521-17-7 |
| Literature: Vogt; Jeske Archiv der Pharmazie (Weinheim, Germany), 1958 , vol. 291, p. 168,175 |
|
~%
7-bromo-5-nitro... CAS#:23521-17-7 |
| Literature: Petrow; Sturgeon Journal of the Chemical Society, 1954 , p. 570,572 |
| 7-bromo-5-nitro-quinolin-8-ol |
| 7-bromo-5-nitro-8-hydroxyquinoline |
| 8-Quinolinol,7-bromo-5-nitro |
| 5-Nitro-7-brom-8-chinolinol |
| 7-Brom-5-nitro-chinolin-8-ol |
| 5-Nitro-7-brom-8-hydroxy-chinolin |
| 7-bromo-8-hydroxy-5-nitroquinoline |