DBCO-PEG6-amine,DBCO-PEG6-NH2 structure
|
Common Name | DBCO-PEG6-amine,DBCO-PEG6-NH2 | ||
|---|---|---|---|---|
| CAS Number | 2353409-98-8 | Molecular Weight | 611.73 | |
| Density | 1.22±0.1 g/cm3(Predicted) | Boiling Point | 823.0±65.0 °C(Predicted) | |
| Molecular Formula | C33H45N3O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of DBCO-PEG6-amine,DBCO-PEG6-NH2DBCO-PEG6-amine is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | DBCO-PEG6-amine |
|---|
| Description | DBCO-PEG6-amine is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.22±0.1 g/cm3(Predicted) |
|---|---|
| Boiling Point | 823.0±65.0 °C(Predicted) |
| Molecular Formula | C33H45N3O8 |
| Molecular Weight | 611.73 |
| InChIKey | SHIACZLTEDAJEG-UHFFFAOYSA-N |
| SMILES | NCCOCCOCCOCCOCCOCCOCCNC(=O)CCC(=O)N1Cc2ccccc2C#Cc2ccccc21 |