N-(3-Chloro-p-tolyl)isonicotinamidine structure
|
Common Name | N-(3-Chloro-p-tolyl)isonicotinamidine | ||
|---|---|---|---|---|
| CAS Number | 23564-67-2 | Molecular Weight | 245.70700 | |
| Density | 1.23g/cm3 | Boiling Point | 433.4ºC at 760mmHg | |
| Molecular Formula | C13H12ClN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.9ºC | |
| Name | N'-(3-chloro-4-methylphenyl)pyridine-4-carboximidamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 433.4ºC at 760mmHg |
| Molecular Formula | C13H12ClN3 |
| Molecular Weight | 245.70700 |
| Flash Point | 215.9ºC |
| Exact Mass | 245.07200 |
| PSA | 51.27000 |
| LogP | 3.78070 |
| Vapour Pressure | 1.02E-07mmHg at 25°C |
| Index of Refraction | 1.616 |
| InChIKey | NUNHPHHBQUMIGL-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N=C(N)c2ccncc2)cc1Cl |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Chloro-3'-methyl-4'-phenyl-pyridino-4-amidin |
| N-(3-Chloro-p-tolyl)isonicotinamidine |
| ISONICOTINAMIDINE,N-(3-CHLORO-p-TOLYL) |
| 4-Pyridinecarboximidamide,N-(3-chloro-4-methylphenyl) |