4-tert-Butylpyridine 1-oxide structure
|
Common Name | 4-tert-Butylpyridine 1-oxide | ||
|---|---|---|---|---|
| CAS Number | 23569-17-7 | Molecular Weight | 151.206 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 286.6±9.0 °C at 760 mmHg | |
| Molecular Formula | C9H13NO | Melting Point | 104-108°C | |
| MSDS | N/A | Flash Point | 127.1±18.7 °C | |
| Name | 4-tert-Butylpyridine 1-oxide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 286.6±9.0 °C at 760 mmHg |
| Melting Point | 104-108°C |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.206 |
| Flash Point | 127.1±18.7 °C |
| Exact Mass | 151.099716 |
| PSA | 25.46000 |
| LogP | 0.49 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.491 |
| InChIKey | CMFQXPIZAKBRCG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc[n+]([O-])cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
|
~99%
4-tert-Butylpyr... CAS#:23569-17-7 |
| Literature: Hendricks, Robert Than; Hermann, Johannes; Kondru, Rama; Lou, Yan; Lynch, Stephen M.; Owens, Timothy D.; Soth, Michael Patent: US2011/230462 A1, 2011 ; Location in patent: Page/Page column 97 ; US 20110230462 A1 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Pyridine, 4-(1,1-dimethylethyl)-, 1-oxide |
| 4-tert-butyl-1-oxypyridine |
| 4-t-Butyl-pyridin-boran |
| 4-t-C4H9-C5H4N*BH3 |
| 4-tert-butylpyridine-N-oxide |
| 4-(2-Methyl-2-propanyl)pyridine 1-oxide |
| Pyridine,4-(1,1-dimethylethyl)-,compd. with borane (1:1) |
| 4-t-butylpyridine-N-oxide |
| 4-tert-Butylpyridine 1-oxide |
| 4-tert-butylpyridine1-oxide |