3-[5-(4-Chloro-phenyl)-furan-2-yl]-propionic acid structure
|
Common Name | 3-[5-(4-Chloro-phenyl)-furan-2-yl]-propionic acid | ||
|---|---|---|---|---|
| CAS Number | 23589-02-8 | Molecular Weight | 250.67800 | |
| Density | 1.296g/cm3 | Boiling Point | 392.8ºC at 760mmHg | |
| Molecular Formula | C13H11ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.4ºC | |
| Name | 3-[5-(4-Chloro-phenyl)-furan-2-yl]-propionic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.296g/cm3 |
|---|---|
| Boiling Point | 392.8ºC at 760mmHg |
| Molecular Formula | C13H11ClO3 |
| Molecular Weight | 250.67800 |
| Flash Point | 191.4ºC |
| Exact Mass | 250.04000 |
| PSA | 50.44000 |
| LogP | 3.61720 |
| Vapour Pressure | 7.1E-07mmHg at 25°C |
| Index of Refraction | 1.573 |
| InChIKey | FIXOHABRIXQDMY-UHFFFAOYSA-N |
| SMILES | O=C(O)CCc1ccc(-c2ccc(Cl)cc2)o1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2932190090 |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 3-[5-(4-chlorophenyl)furan-2-yl]propanoic acid |
| 3-(5-(4-CHLOROPHENYL)-2-FURYL)PROPANOIC ACID |