3-(5-P-TOLYL-FURAN-2-YL)-PROPIONIC ACID structure
|
Common Name | 3-(5-P-TOLYL-FURAN-2-YL)-PROPIONIC ACID | ||
|---|---|---|---|---|
| CAS Number | 23589-06-2 | Molecular Weight | 230.25900 | |
| Density | N/A | Boiling Point | 377.2ºC at 760mmHg | |
| Molecular Formula | C14H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.9ºC | |
| Name | 3-[5-(4-methylphenyl)furan-2-yl]propanoate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 377.2ºC at 760mmHg |
|---|---|
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.25900 |
| Flash Point | 181.9ºC |
| Exact Mass | 230.09400 |
| PSA | 50.44000 |
| LogP | 3.27220 |
| Vapour Pressure | 2.32E-06mmHg at 25°C |
| Index of Refraction | 1.557 |
| InChIKey | XIEFXNUAGJCARS-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2ccc(CCC(=O)O)o2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2932190090 |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 3-(5-p-tolyl-furan-2-yl)-propionic acid |
| 3-[5-(4-methylphenyl)-2-furanyl]propanoate |