5-tert-Butylisophthalic Acid structure
|
Common Name | 5-tert-Butylisophthalic Acid | ||
|---|---|---|---|---|
| CAS Number | 2359-09-3 | Molecular Weight | 222.237 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 400.0±42.0 °C at 760 mmHg | |
| Molecular Formula | C12H14O4 | Melting Point | >300 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 209.8±24.4 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 5-tert-butylbenzene-1,3-dicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 400.0±42.0 °C at 760 mmHg |
| Melting Point | >300 °C(lit.) |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.237 |
| Flash Point | 209.8±24.4 °C |
| Exact Mass | 222.089203 |
| PSA | 74.60000 |
| LogP | 3.35 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.559 |
| InChIKey | BJLUCDZIWWSFIB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(C(=O)O)cc(C(=O)O)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2917399090 |
| Precursor 9 | |
|---|---|
| DownStream 3 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| MFCD00067047 |
| 5-tert-Butyl-1,3-benzenedicarboxylic acid |
| 5-tert-butylbenzene-1,3-dioic acid |
| 5-tert-butylbenzene-1,3-dicarboxylic acid |
| EINECS 219-100-2 |
| 5-tert Butyl isophthalic acid |
| 5-(2-Methyl-2-propanyl)isophthalic acid |
| 5-tert-butyl isophthalic acid |
| 1,3-Benzenedicarboxylic acid, 5-(1,1-dimethylethyl)- |
| 5-tert-Butylisophthalic Acid |
| 5-(tert-Butyl)isophthalic acid |
| 1,3-Benzenedicarboxylic acid,5-(1,1-dimethylethyl) |