OICR12694
Modify Date: 2025-12-03 19:12:03
OICR12694 structure
|
Common Name | OICR12694 | ||
|---|---|---|---|---|
| CAS Number | 2360625-97-2 | Molecular Weight | 645.03 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H28ClF3N8O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of OICR12694OICR12694 (JNJ-65234637) is an orally active inhibitor of B cell lymphoma 6 (BCL6)[1]. |
| Name | OICR12694 |
|---|
| Description | OICR12694 (JNJ-65234637) is an orally active inhibitor of B cell lymphoma 6 (BCL6)[1]. |
|---|---|
| Related Catalog | |
| Target |
B cell lymphoma 6 (BCL6)[1] |
| References |
| Molecular Formula | C29H28ClF3N8O4 |
|---|---|
| Molecular Weight | 645.03 |
| InChIKey | LGAFZGSECXDYIR-ZDUSSCGKSA-N |
| SMILES | CC1CN(C)CCN1c1cc(NC(=O)Cn2cc(-c3cc(C(N)=O)c(O)c(F)c3F)c3c(=O)n4c(nc32)CCC4)c(Cl)c(F)n1 |