CCW16 structure
|
Common Name | CCW16 | ||
|---|---|---|---|---|
| CAS Number | 2361138-33-0 | Molecular Weight | 381.852 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 533.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C22H20ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 276.3±30.1 °C | |
Use of CCW16CCW16 is the covalent ligand for the E3 ubiquitin ligase RNF4. CCW16 can be used in the synthesis of protein degraders[1]. |
| Name | CCW16 |
|---|---|
| Synonym | More Synonyms |
| Description | CCW16 is the covalent ligand for the E3 ubiquitin ligase RNF4. CCW16 can be used in the synthesis of protein degraders[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 533.2±50.0 °C at 760 mmHg |
| Molecular Formula | C22H20ClNO3 |
| Molecular Weight | 381.852 |
| Flash Point | 276.3±30.1 °C |
| Exact Mass | 381.113159 |
| LogP | 3.66 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.617 |
| InChIKey | DPADEQNOMBTITM-UHFFFAOYSA-N |
| SMILES | COc1ccc(Oc2ccc(N(Cc3ccccc3)C(=O)CCl)cc2)cc1 |
| Acetamide, 2-chloro-N-[4-(4-methoxyphenoxy)phenyl]-N-(phenylmethyl)- |
| N-Benzyl-2-chloro-N-[4-(4-methoxyphenoxy)phenyl]acetamide |