4-amino-N-[4-[(4-aminobenzoyl)amino]phenyl]benzamide structure
|
Common Name | 4-amino-N-[4-[(4-aminobenzoyl)amino]phenyl]benzamide | ||
|---|---|---|---|---|
| CAS Number | 2362-26-7 | Molecular Weight | 346.38300 | |
| Density | 1.375g/cm3 | Boiling Point | 481.3ºC at 760mmHg | |
| Molecular Formula | C20H18N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.9ºC | |
| Name | 4-amino-N-[4-[(4-aminobenzoyl)amino]phenyl]benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.375g/cm3 |
|---|---|
| Boiling Point | 481.3ºC at 760mmHg |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.38300 |
| Flash Point | 244.9ºC |
| Exact Mass | 346.14300 |
| PSA | 117.22000 |
| LogP | 5.28600 |
| Vapour Pressure | 2.02E-09mmHg at 25°C |
| Index of Refraction | 1.762 |
| InChIKey | LGTGOCSQAOUUFP-UHFFFAOYSA-N |
| SMILES | Nc1ccc(C(=O)Nc2ccc(NC(=O)c3ccc(N)cc3)cc2)cc1 |
|
~%
4-amino-N-[4-[(... CAS#:2362-26-7 |
| Literature: Rao; Sasisekharan Indian Journal of Chemistry - Section B Organic Chemistry Including Medicinal Chemistry, 1990 , vol. 29, # 6 p. 503 - 507 |
|
~%
4-amino-N-[4-[(... CAS#:2362-26-7 |
| Literature: Rao; Sasisekharan Indian Journal of Chemistry - Section B Organic Chemistry Including Medicinal Chemistry, 1990 , vol. 29, # 6 p. 503 - 507 |
|
~%
4-amino-N-[4-[(... CAS#:2362-26-7 |
| Literature: Rao; Sasisekharan Indian Journal of Chemistry - Section B Organic Chemistry Including Medicinal Chemistry, 1990 , vol. 29, # 6 p. 503 - 507 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N,N'-(p-phenylene)bis(p-aminobenzamide) |
| bis-1,4-(4-aminobenzamido)benzene |
| Benzamide,N,N'-1,4-phenylenebis(4-amino |
| N,N'-1,4-Phenylenebis(4-aminobenzamide) |