LAS17
Modify Date: 2025-08-21 09:45:45
LAS17 structure
|
Common Name | LAS17 | ||
|---|---|---|---|---|
| CAS Number | 2362527-67-9 | Molecular Weight | 359.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H20Cl2N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of LAS17Novel highly potent, selective, and irreversible GSTP1 inhibitor |
| Name | LAS17 |
|---|
| Description | Novel highly potent, selective, and irreversible GSTP1 inhibitor |
|---|
| Molecular Formula | C15H20Cl2N4O2 |
|---|---|
| Molecular Weight | 359.25 |
| InChIKey | UTXOIMJGBZBFGA-LLVKDONJSA-N |
| SMILES | C#CCCCN(c1nc(Cl)nc(Cl)n1)C(CC(C)C)C(=O)OC |
| Hazard Codes | Xi |
|---|