Kaempferol-3-O-galactoside
Kaempferol-3-O-galactoside structure
|
Common Name | Kaempferol-3-O-galactoside | ||
|---|---|---|---|---|
| CAS Number | 23627-87-4 | Molecular Weight | 448.377 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 823.2±65.0 °C at 760 mmHg | |
| Molecular Formula | C21H20O11 | Melting Point | 245-246℃ | |
| MSDS | N/A | Flash Point | 291.6±27.8 °C | |
Use of Kaempferol-3-O-galactosideKaempferol 3-O-β-D-galactopyranoside (Trifolin) is a derivative of flavonoid, which is isolated from the aerial part of Consolida oliveriana[1]. |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | kaempferol 3-O-β-D-galactoside |
|---|---|
| Synonym | More Synonyms |
This table contains bioactivity, target information and biological‑assay experimental data of this compound.
| Description | Kaempferol 3-O-β-D-galactopyranoside (Trifolin) is a derivative of flavonoid, which is isolated from the aerial part of Consolida oliveriana[1]. |
|---|---|
| Related Catalog | |
| References |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 823.2±65.0 °C at 760 mmHg |
| Melting Point | 245-246℃ |
| Molecular Formula | C21H20O11 |
| Molecular Weight | 448.377 |
| Flash Point | 291.6±27.8 °C |
| Exact Mass | 448.100555 |
| PSA | 190.28000 |
| LogP | 1.95 |
| Vapour Pressure | 0.0±3.1 mmHg at 25°C |
| Index of Refraction | 1.774 |
| InChIKey | JPUKWEQWGBDDQB-DTGCRPNFSA-N |
| SMILES | O=c1c(OC2OC(CO)C(O)C(O)C2O)c(-c2ccc(O)cc2)oc2cc(O)cc(O)c12 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Kaempferol 3-O-β-D-galactoside |
| Kaempferol-3-O-β-D-galactoside |
| Kaempferol-3-O-D-galactopyranoside |
| Trifolin |
| 5,7-Dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-3-yl β-D-galactopyranoside |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of kaempferol 3-O-β-D-galactoside? |
| A: Boiling point of kaempferol 3-O-β-D-galactoside is 823.2±65.0 °C at 760 mmHg. |
| Q: What is the InChIKey of kaempferol 3-O-β-D-galactoside? |
| A: InChIKey of kaempferol 3-O-β-D-galactoside is JPUKWEQWGBDDQB-DTGCRPNFSA-N. |
| Q: What is the English name of kaempferol 3-O-β-D-galactoside? |
| A: The English name of kaempferol 3-O-β-D-galactoside is kaempferol 3-O-β-D-galactoside. |
| Q: What is the CAS number of kaempferol 3-O-β-D-galactoside? |
| A: CAS number of kaempferol 3-O-β-D-galactoside is 23627-87-4. |
| Q: What is the molecular formula of kaempferol 3-O-β-D-galactoside? |
| A: Molecular formula of kaempferol 3-O-β-D-galactoside is C21H20O11. |
| Q: What is the SMILES notation of kaempferol 3-O-β-D-galactoside? |
| A: SMILES notation of kaempferol 3-O-β-D-galactoside is O=c1c(OC2OC(CO)C(O)C(O)C2O)c(-c2ccc(O)cc2)oc2cc(O)cc(O)c12. |
| Q: What is the melting point of kaempferol 3-O-β-D-galactoside? |
| A: Melting point of kaempferol 3-O-β-D-galactoside is 245-246℃. |
| Q: What is the molecular weight of kaempferol 3-O-β-D-galactoside? |
| A: Molecular weight of kaempferol 3-O-β-D-galactoside is 448.377. |
| Q: What is the LogP of kaempferol 3-O-β-D-galactoside? |
| A: LogP of kaempferol 3-O-β-D-galactoside is 1.95. |
| Q: What English synonyms does kaempferol 3-O-β-D-galactoside have? |
| A: English synonyms of kaempferol 3-O-β-D-galactoside: Kaempferol 3-O-β-D-galactoside, Kaempferol-3-O-β-D-galactoside, Kaempferol-3-O-D-galactopyranoside, Trifolin, 5,7-Dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-3-yl β-D-galactopyranoside. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| BioBioPha |
| naturewill |