Kaempferol-3-O-galactoside structure
|
Common Name | Kaempferol-3-O-galactoside | ||
|---|---|---|---|---|
| CAS Number | 23627-87-4 | Molecular Weight | 448.377 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 823.2±65.0 °C at 760 mmHg | |
| Molecular Formula | C21H20O11 | Melting Point | 245-246℃ | |
| MSDS | N/A | Flash Point | 291.6±27.8 °C | |
Use of Kaempferol-3-O-galactosideKaempferol 3-O-β-D-galactopyranoside (Trifolin) is a derivative of flavonoid, which is isolated from the aerial part of Consolida oliveriana[1]. |
| Name | kaempferol 3-O-β-D-galactoside |
|---|---|
| Synonym | More Synonyms |
| Description | Kaempferol 3-O-β-D-galactopyranoside (Trifolin) is a derivative of flavonoid, which is isolated from the aerial part of Consolida oliveriana[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 823.2±65.0 °C at 760 mmHg |
| Melting Point | 245-246℃ |
| Molecular Formula | C21H20O11 |
| Molecular Weight | 448.377 |
| Flash Point | 291.6±27.8 °C |
| Exact Mass | 448.100555 |
| PSA | 190.28000 |
| LogP | 1.95 |
| Vapour Pressure | 0.0±3.1 mmHg at 25°C |
| Index of Refraction | 1.774 |
| InChIKey | JPUKWEQWGBDDQB-DTGCRPNFSA-N |
| SMILES | O=c1c(OC2OC(CO)C(O)C(O)C2O)c(-c2ccc(O)cc2)oc2cc(O)cc(O)c12 |
| Hazard Codes | Xi |
|---|
| Kaempferol 3-O-β-D-galactoside |
| Kaempferol-3-O-β-D-galactoside |
| Kaempferol-3-O-D-galactopyranoside |
| Trifolin |
| 5,7-Dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-3-yl β-D-galactopyranoside |