Fmoc-Gly-Gly-Phe-OtBu
Modify Date: 2025-08-25 18:37:41
Fmoc-Gly-Gly-Phe-OtBu structure
|
Common Name | Fmoc-Gly-Gly-Phe-OtBu | ||
|---|---|---|---|---|
| CAS Number | 236426-37-2 | Molecular Weight | 557.64 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H35N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Fmoc-Gly-Gly-Phe-OtBuFmoc-Gly-Gly-Phe-OtBu is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | Fmoc-Gly-Gly-Phe-OtBu |
|---|
| Description | Fmoc-Gly-Gly-Phe-OtBu is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| References |
| Molecular Formula | C32H35N3O6 |
|---|---|
| Molecular Weight | 557.64 |
| InChIKey | XQLGBXCTOOARCT-MHZLTWQESA-N |
| SMILES | CC(C)(C)OC(=O)C(Cc1ccccc1)NC(=O)CNC(=O)CNC(=O)OCC1c2ccccc2-c2ccccc21 |