Fmoc-Gly-Gly-Phe-OH structure
|
Common Name | Fmoc-Gly-Gly-Phe-OH | ||
|---|---|---|---|---|
| CAS Number | 160036-44-2 | Molecular Weight | 501.53 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H27N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Fmoc-Gly-Gly-Phe-OHFmoc-Gly-Gly-Phe-OH is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | Fmoc-Gly-Gly-Phe-OH |
|---|
| Description | Fmoc-Gly-Gly-Phe-OH is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| References |
| Molecular Formula | C28H27N3O6 |
|---|---|
| Molecular Weight | 501.53 |
| InChIKey | UFGUUZVZUIXKQZ-DEOSSOPVSA-N |
| SMILES | O=C(CNC(=O)OCC1c2ccccc2-c2ccccc21)NCC(=O)NC(Cc1ccccc1)C(=O)O |
| Storage condition | 2-8°C |