Vicenin -2 structure
|
Common Name | Vicenin -2 | ||
|---|---|---|---|---|
| CAS Number | 23666-13-9 | Molecular Weight | 594.518 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 974.7±65.0 °C at 760 mmHg | |
| Molecular Formula | C27H30O15 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 323.7±27.8 °C | |
Use of Vicenin -2Vicenin 2 is an angiotensin-converting enzyme (ACE) inhibitor (IC50=43.83 μM) from the aerial parts of Desmodium styracifolium[1]. |
| Name | vicenin |
|---|---|
| Synonym | More Synonyms |
| Description | Vicenin 2 is an angiotensin-converting enzyme (ACE) inhibitor (IC50=43.83 μM) from the aerial parts of Desmodium styracifolium[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 974.7±65.0 °C at 760 mmHg |
| Molecular Formula | C27H30O15 |
| Molecular Weight | 594.518 |
| Flash Point | 323.7±27.8 °C |
| Exact Mass | 594.158447 |
| PSA | 271.20000 |
| LogP | -0.10 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.749 |
| InChIKey | FIAAVMJLAGNUKW-VQVVXJKKSA-N |
| SMILES | O=c1cc(-c2ccc(O)cc2)oc2c(C3OC(CO)C(O)C(O)C3O)c(O)c(C3OC(CO)C(O)C(O)C3O)c(O)c12 |
| Storage condition | 2-8℃ |
| 5,7-Dihydroxy-2-(4-hydroxyphenyl)-6,8-bis[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one |
| 4H-1-Benzopyran-4-one, 6,8-di-β-D-glucopyranosyl-5,7-dihydroxy-2-(4-hydroxyphenyl)- |
| Apigenin 6,8-C-diglucoside |
| Vicenin II |
| Vicenin-2 |
| isovitexin 8-C-β-glucoside |
| 5,7,4'-trihydroxyflavone 6,8-di-C-glucoside |
| 5,7-Dihydroxy-2-(4-hydroxyphenyl)-6,8-bis[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl]-4H-chromen-4-one |