para-TOPOLIN RIBOSIDE(pTR) structure
|
Common Name | para-TOPOLIN RIBOSIDE(pTR) | ||
|---|---|---|---|---|
| CAS Number | 23666-24-2 | Molecular Weight | 387.39 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H21N5O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of para-TOPOLIN RIBOSIDE(pTR)N6-(4-Methoxybenzyl)adenosine is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. |
| Name | N6-(4-methoxybenzyl)adenosine |
|---|---|
| Synonym | More Synonyms |
| Description | N6-(4-Methoxybenzyl)adenosine is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C18H21N5O5 |
|---|---|
| Molecular Weight | 387.39 |
| Exact Mass | 387.15400 |
| PSA | 134.78000 |
| LogP | 0.13150 |
| InChIKey | LZNPQLJNXKVMMY-SCFUHWHPSA-N |
| SMILES | COc1ccc(CNc2ncnc3c2ncn3C2OC(CO)C(O)C2O)cc1 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| para-topolin riboside |