4-chloro-2-[(4-fluorophenyl)amino]benzoic acid structure
|
Common Name | 4-chloro-2-[(4-fluorophenyl)amino]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 2367-04-6 | Molecular Weight | 265.66700 | |
| Density | 1.442g/cm3 | Boiling Point | 395.7ºC at 760 mmHg | |
| Molecular Formula | C13H9ClFNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.1ºC | |
| Name | 4-chloro-2-(4-fluoroanilino)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.442g/cm3 |
|---|---|
| Boiling Point | 395.7ºC at 760 mmHg |
| Molecular Formula | C13H9ClFNO2 |
| Molecular Weight | 265.66700 |
| Flash Point | 193.1ºC |
| Exact Mass | 265.03100 |
| PSA | 49.33000 |
| LogP | 3.99390 |
| Vapour Pressure | 5.7E-07mmHg at 25°C |
| Index of Refraction | 1.653 |
| InChIKey | VQECJUGGSQMKIK-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(Cl)cc1Nc1ccc(F)cc1 |
| HS Code | 2922499990 |
|---|
|
~55%
4-chloro-2-[(4-... CAS#:2367-04-6 |
| Literature: Kitchen, S. E.; Wang, Yueh-Hwa; Baumstark, A. L.; Wilson, W. D.; Boykin, D. W. Journal of Medicinal Chemistry, 1985 , vol. 28, # 7 p. 940 - 944 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 4-chloro-2-(4-fluoro-anilino)-benzoic acid |
| 5-chloro-4'-fluoro-diphenylamine-2-carboxylic acid |
| 4-Chlor-2-(4-fluor-anilino)-benzoesaeure |
| 4-chloro-2-[(4-fluorophenyl)amino]benzoic acid |