3-Fluoro-5-nitroaniline structure
|
Common Name | 3-Fluoro-5-nitroaniline | ||
|---|---|---|---|---|
| CAS Number | 2369-12-2 | Molecular Weight | 156.115 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 314.3±22.0 °C at 760 mmHg | |
| Molecular Formula | C6H5FN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143.9±22.3 °C | |
| Name | 3-fluoro-5-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 314.3±22.0 °C at 760 mmHg |
| Molecular Formula | C6H5FN2O2 |
| Molecular Weight | 156.115 |
| Flash Point | 143.9±22.3 °C |
| Exact Mass | 156.033508 |
| PSA | 71.84000 |
| LogP | 1.72 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.603 |
| InChIKey | OPMFAZASMJCCOQ-UHFFFAOYSA-N |
| SMILES | Nc1cc(F)cc([N+](=O)[O-])c1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2921420090 |
|
~%
3-Fluoro-5-nitr... CAS#:2369-12-2 |
| Literature: Anales de la Asociacion Quimica Argentina (1921-2001), , vol. 24, p. 119,124, 127 An. Soc. cient. arg., , vol. 125, p. 55 |
|
~%
3-Fluoro-5-nitr... CAS#:2369-12-2 |
| Literature: Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), , p. 1860 - 1862 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 5-fluoro-3-nitroaniline |
| 3-Fluor-5-nitro-anilin |
| Benzenamine, 3-fluoro-5-nitro- |
| 3-nitro-5-fluoroaniline |
| 3-fluoro-5-nitrobenzenamine |
| EINECS 219-129-0 |
| 3-Fluoro-5-nitro-phenylamine |
| 3-Fluoro-5-nitroaniline |
| 3-fluoro-5-nitro-aniline |