Glycine,N-(3-chloro-4-fluorophenyl)-, hydrazide structure
|
Common Name | Glycine,N-(3-chloro-4-fluorophenyl)-, hydrazide | ||
|---|---|---|---|---|
| CAS Number | 2370-44-7 | Molecular Weight | 217.62800 | |
| Density | 1.439g/cm3 | Boiling Point | 473.9ºC at 760 mmHg | |
| Molecular Formula | C8H9ClFN3O | Melting Point | 99-100ºC | |
| MSDS | N/A | Flash Point | 240.4ºC | |
| Name | 2-(3-Chloro-4-fluoroanilino)acetohydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.439g/cm3 |
|---|---|
| Boiling Point | 473.9ºC at 760 mmHg |
| Melting Point | 99-100ºC |
| Molecular Formula | C8H9ClFN3O |
| Molecular Weight | 217.62800 |
| Flash Point | 240.4ºC |
| Exact Mass | 217.04200 |
| PSA | 67.15000 |
| LogP | 2.04510 |
| Vapour Pressure | 3.79E-09mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | KVTCQXCNZAAMDB-UHFFFAOYSA-N |
| SMILES | NNC(=O)CNc1ccc(F)c(Cl)c1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2928000090 |
|
~%
Glycine,N-(3-ch... CAS#:2370-44-7 |
| Literature: Chemical Biology and Drug Design, , vol. 81, # 6 p. 715 - 729 |
|
~%
Glycine,N-(3-ch... CAS#:2370-44-7 |
| Literature: Chemical Biology and Drug Design, , vol. 81, # 6 p. 715 - 729 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| N-(3-Chlor-4-fluor-phenyl)-glycin-hydrazid |
| N-(3-Chloro-4-fluorophenyl)glycinehydrazide |
| chlorofluoroanilinoacetohydrazide |
| 4-fluoro-3-chlorophenylaminoethanehydrazide |