TETRAMETHYLCYCLOTETRASILOXANE structure
|
Common Name | TETRAMETHYLCYCLOTETRASILOXANE | ||
|---|---|---|---|---|
| CAS Number | 2370-88-9 | Molecular Weight | 240.509 | |
| Density | 0.986 g/mL at 25 °C(lit.) | Boiling Point | 134.5±0.0 °C at 760 mmHg | |
| Molecular Formula | C4H16O4Si4 | Melting Point | −69 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 31.5±18.7 °C | |
| Symbol |
GHS02 |
Signal Word | Warning | |
| Name | 2,4,6,8-tetramethyl-1,3,5,7,2λ3,4λ3,6λ3,8λ3-tetraoxatetrasilocane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.986 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 134.5±0.0 °C at 760 mmHg |
| Melting Point | −69 °C(lit.) |
| Molecular Formula | C4H16O4Si4 |
| Molecular Weight | 240.509 |
| Flash Point | 31.5±18.7 °C |
| Exact Mass | 240.012558 |
| PSA | 36.92000 |
| Vapour Pressure | 9.9±0.2 mmHg at 25°C |
| Index of Refraction | n20/D 1.387(lit.) |
| InChIKey | WZJUBBHODHNQPW-UHFFFAOYSA-N |
| SMILES | C[Si]1O[Si](C)O[Si](C)O[Si](C)O1 |
| Storage condition | Flammables area |
| Symbol |
GHS02 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H226 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R10;R36 |
| Safety Phrases | S16-S26-S36 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 3 |
| HS Code | 2901100000 |
| Precursor 6 | |
|---|---|
| DownStream 6 | |
| HS Code | 2901100000 |
|---|---|
| Summary | 2901100000 saturated acyclic hydrocarbons。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:2.0%。General tariff:30.0% |
|
Hierarchical superstructures from a star-shaped molecule consisting of a cyclic oligosiloxane with cyanobiphenyl moieties.
Soft Matter 11(1) , 58-68, (2014) Unconventional star-shaped liquid crystals (abbreviated as SiLCs) were successfully synthesized by chemically connecting four cyanobiphenyl anisotropic mesogens to the periphery of a super-hydrophobic... |
|
|
Ward, L. J.; et al.
Langmuir 19 , 2110, (2003)
|
|
|
Pai, C. S.; et al.
Mater. Chem. Phys. 44 , 1, (1996)
|
| 1,3,5,7-tetramethylcyclotetrasiloxane |
| tetramethylcyclohydrosiloxane |
| 2,4,6,8-tetramethylcyclotetrasiloxane |
| cyclic tetramethyltetrasiloxane |
| 1,3,5,7-Tetramethyl Cyclotetrasiloxane |
| 1,3,5,7-Cyclotetra(methylsiloxane) 1,3,5,7-Tetramethylcyclotetrasiloxane TMCTS |
| MFCD00039567 |
| TETRAMETHYLCYCLOTETRASILOXANE |
| TMCTS |
| 2,4,6,8-Tetramethyl-1,3,5,7,2,4,6,8-tetroxatetrasilocane |
| EINECS 219-137-4 |
| 2,4,6,8-Tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| Cyclotetrasiloxane,2,4,6,8-tetramethyl |
| Cyclotetrasiloxane, 2,4,6,8-tetramethyl- |
| 1,3,5,7-Cyclotetra(methylsiloxane),1,3,5,7-Tetramethylcyclotetrasiloxane,TMCTS |