1H-Imidazole,1-(triphenylplumbyl)- structure
|
Common Name | 1H-Imidazole,1-(triphenylplumbyl)- | ||
|---|---|---|---|---|
| CAS Number | 23705-91-1 | Molecular Weight | 505.58100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H18N2Pb | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | imidazol-1-yl(triphenyl)plumbane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H18N2Pb |
|---|---|
| Molecular Weight | 505.58100 |
| Exact Mass | 506.12400 |
| PSA | 17.82000 |
| LogP | 4.27510 |
| InChIKey | BTICMZIMPVQEJX-UHFFFAOYSA-N |
| SMILES | c1ccc([Pb](c2ccccc2)(c2ccccc2)n2ccnc2)cc1 |
|
~%
1H-Imidazole,1-... CAS#:23705-91-1 |
| Literature: Gaffney, Christine; Harrison, Philip G. Journal of the Chemical Society, Dalton Transactions: Inorganic Chemistry (1972-1999), 1982 , p. 1055 - 1060 |
|
~%
1H-Imidazole,1-... CAS#:23705-91-1 |
| Literature: Gaffney, Christine; Harrison, Philip G. Journal of the Chemical Society, Dalton Transactions: Inorganic Chemistry (1972-1999), 1982 , p. 1055 - 1060 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-triphenylplumbanyl-1H-imidazole |