2-Bromo-1-[3-(trifluoromethoxy)phenyl]ethanone structure
|
Common Name | 2-Bromo-1-[3-(trifluoromethoxy)phenyl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 237386-01-5 | Molecular Weight | 283.042 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 240.9±35.0 °C at 760 mmHg | |
| Molecular Formula | C9H6BrF3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 99.5±25.9 °C | |
| Name | 2-bromo-1-[3-(trifluoromethoxy)phenyl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 240.9±35.0 °C at 760 mmHg |
| Molecular Formula | C9H6BrF3O2 |
| Molecular Weight | 283.042 |
| Flash Point | 99.5±25.9 °C |
| Exact Mass | 281.950317 |
| PSA | 26.30000 |
| LogP | 3.40 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.498 |
| InChIKey | QUKYVVGHLJGVEQ-UHFFFAOYSA-N |
| SMILES | O=C(CBr)c1cccc(OC(F)(F)F)c1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914700090 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2-Bromo-1-[3-(trifluoromethoxy)phenyl]ethanone |
| Ethanone, 2-bromo-1-[3-(trifluoromethoxy)phenyl]- |
| 2-Bromo-3'-trifluoromethoxyacetophenone |
| 2-bromo-1-(3-trifluoromethoxy-phenyl)ethanone |
| 2-bromo-1-[3-(trifluoromethoxy)phenyl]-ethan-1-one |
| 3-trifluoromethoxyphenacyl bromide |