5-Chloro-2-phenyl-1H-indole structure
|
Common Name | 5-Chloro-2-phenyl-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 23746-76-1 | Molecular Weight | 227.689 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 423.3±25.0 °C at 760 mmHg | |
| Molecular Formula | C14H10ClN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.3±8.8 °C | |
| Name | 5-chloro-2-phenyl-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 423.3±25.0 °C at 760 mmHg |
| Molecular Formula | C14H10ClN |
| Molecular Weight | 227.689 |
| Flash Point | 242.3±8.8 °C |
| Exact Mass | 227.050171 |
| PSA | 15.79000 |
| LogP | 5.46 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.684 |
| InChIKey | GQGZSWYJDNGSBE-UHFFFAOYSA-N |
| SMILES | Clc1ccc2[nH]c(-c3ccccc3)cc2c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| Precursor 8 | |
|---|---|
| DownStream 3 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-chloro-2-phenylindole |
| 5-Chlor-2-phenyl-indol |
| 2-phenyl-5-chloro-1H-indole |
| 5-chlor-2-phenyl-1H-indole |
| 1H-Indole, 5-chloro-2-phenyl- |
| 5-Chloro-2-phenyl-1H-indole |