Methoxydimethyl(pentafluorophenyl)silane structure
|
Common Name | Methoxydimethyl(pentafluorophenyl)silane | ||
|---|---|---|---|---|
| CAS Number | 23761-74-2 | Molecular Weight | 256.24500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9F5OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methoxy-dimethyl-(2,3,4,5,6-pentafluorophenyl)silane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H9F5OSi |
|---|---|
| Molecular Weight | 256.24500 |
| Exact Mass | 256.03400 |
| PSA | 9.23000 |
| LogP | 2.44060 |
| InChIKey | CEEVCOGSFYACND-UHFFFAOYSA-N |
| SMILES | CO[Si](C)(C)c1c(F)c(F)c(F)c(F)c1F |
| HS Code | 2931900090 |
|---|
|
~48%
Methoxydimethyl... CAS#:23761-74-2 |
| Literature: Lapkin, I. I.; Mukhina, R. G.; Kirillov, N. F. J. Gen. Chem. USSR (Engl. Transl.), 1987 , vol. 57, # 1 p. 146 - 151,125 - 129 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| dimethyl(2,3,4,5,6-pentafluorophenyl)methoxysilane |
| Silane,methoxydimethyl(pentafluorophenyl) |
| Methoxy(dimethyl)(2,3,4,5,6-pentafluorophenyl)silane |
| Methyl-flophemesyl-ether |
| Dimethyl-methoxy-pentafluorphenyl-silan |
| Methoxydimethyl(pentafluorophenyl)silane |