Triethoxy(pentafluorophenyl)silane structure
|
Common Name | Triethoxy(pentafluorophenyl)silane | ||
|---|---|---|---|---|
| CAS Number | 20083-34-5 | Molecular Weight | 330.323 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 245.4±40.0 °C at 760 mmHg | |
| Molecular Formula | C12H15F5O3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 102.2±27.3 °C | |
| Name | triethoxy-(2,3,4,5,6-pentafluorophenyl)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 245.4±40.0 °C at 760 mmHg |
| Molecular Formula | C12H15F5O3Si |
| Molecular Weight | 330.323 |
| Flash Point | 102.2±27.3 °C |
| Exact Mass | 330.071075 |
| PSA | 27.69000 |
| LogP | 3.17 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.432 |
| InChIKey | QALDFNLNVLQDSP-UHFFFAOYSA-N |
| SMILES | CCO[Si](OCC)(OCC)c1c(F)c(F)c(F)c(F)c1F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| WGK Germany | 3 |
|
~53%
Triethoxy(penta... CAS#:20083-34-5 |
| Literature: Journal of Organometallic Chemistry, , vol. 13, p. 125 - 129 |
|
~%
Triethoxy(penta... CAS#:20083-34-5 |
| Literature: New Journal of Chemistry, , vol. 27, # 1 p. 166 - 171 |
|
~%
Triethoxy(penta... CAS#:20083-34-5 |
| Literature: Journal of Organometallic Chemistry, , vol. 13, p. 125 - 129 |
|
~%
Detail
|
| Literature: Journal of Organometallic Chemistry, , vol. 13, p. 125 - 129 |
| pentafluorophenyltriethoxysilane |
| Benzene, 1,2,3,4,5-pentafluoro-6-(triethoxysilyl)- |
| (Pentafluorphenyl)-triethoxysilan |
| (Pentafluorophenyl)tris(ethoxy)silane |
| MFCD03411257 |
| (EtO)3SiC6F5 |
| pentafluorophenylethoxysilane |
| triethoxy-pentafluorophenyl-silane |
| Pentafluorphenyl-triaethoxysilan |
| Triethoxy(pentafluorophenyl)silane |