5-(4-methoxyphenyl)-1 3 4-oxadiazole-2-& structure
|
Common Name | 5-(4-methoxyphenyl)-1 3 4-oxadiazole-2-& | ||
|---|---|---|---|---|
| CAS Number | 23766-26-9 | Molecular Weight | 208.23700 | |
| Density | 1.38g/cm3 | Boiling Point | 290.1ºC at 760 mmHg | |
| Molecular Formula | C9H8N2O2S | Melting Point | 203-208ºC(lit.) | |
| MSDS | USA | Flash Point | 129.3ºC | |
| Name | 5-(4-methoxyphenyl)-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 290.1ºC at 760 mmHg |
| Melting Point | 203-208ºC(lit.) |
| Molecular Formula | C9H8N2O2S |
| Molecular Weight | 208.23700 |
| Flash Point | 129.3ºC |
| Exact Mass | 208.03100 |
| PSA | 86.95000 |
| LogP | 2.03390 |
| Vapour Pressure | 0.00211mmHg at 25°C |
| Index of Refraction | 1.649 |
| InChIKey | UGHZJAXROLHKEH-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2n[nH]c(=S)o2)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2934999090 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD00462871 |