(4-Methylbenzyl)(triphenyl)phosphonium bromide structure
|
Common Name | (4-Methylbenzyl)(triphenyl)phosphonium bromide | ||
|---|---|---|---|---|
| CAS Number | 2378-86-1 | Molecular Weight | 447.346 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H24BrP | Melting Point | 268-270°C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-methylphenyl)methyl-triphenylphosphanium,bromide |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 268-270°C |
|---|---|
| Molecular Formula | C26H24BrP |
| Molecular Weight | 447.346 |
| Exact Mass | 446.079895 |
| PSA | 13.59000 |
| LogP | 2.49310 |
| InChIKey | CEEKCHGNKYVTTM-UHFFFAOYSA-M |
| SMILES | Cc1ccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.[Br-] |
| Risk Phrases | R22;R36/37/38 |
|---|---|
| Safety Phrases | S26-S36/37/39 |
| RIDADR | 3278 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 4-methylbenzyl triphenylphosphonium bromide |
| Phosphonium, [(4-methylphenyl)methyl]triphenyl-, bromide (1:1) |
| MFCD00031580 |
| (4-Methylbenzyl)triphenylphosphonium bromide |
| (4-Methylbenzyl)(triphenyl)phosphonium bromide |
| EINECS 219-159-4 |