TLR7 agonist 5 structure
|
Common Name | TLR7 agonist 5 | ||
|---|---|---|---|---|
| CAS Number | 2380231-67-2 | Molecular Weight | 482.58 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H30N6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of TLR7 agonist 5TLR7 agonist 5 (compound IIb-11) is an TLR7 agonist with an EC50 value of ~4 nM[1]. |
| Name | TLR7 agonist 5 |
|---|
| Description | TLR7 agonist 5 (compound IIb-11) is an TLR7 agonist with an EC50 value of ~4 nM[1]. |
|---|---|
| Related Catalog | |
| Target |
TLR7:~4 nM (EC50) |
| References |
| Molecular Formula | C28H30N6O2 |
|---|---|
| Molecular Weight | 482.58 |
| InChIKey | RSKKEEYEOIEMPA-UPHRSURJSA-N |
| SMILES | Nc1nc2nc3c1[nH]c(=O)n3Cc1ccc(-c3ccc(CNC4CCC4)cc3)c(c1)CC=CCCO2 |