1-(2,4,5-TRICHLORO-PHENYL)-PYRROLE-2,5-DIONE structure
|
Common Name | 1-(2,4,5-TRICHLORO-PHENYL)-PYRROLE-2,5-DIONE | ||
|---|---|---|---|---|
| CAS Number | 23815-74-9 | Molecular Weight | 261.745 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H20ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2,4,6-trimethoxyphenyl)propan-2-amine,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H20ClNO3 |
|---|---|
| Molecular Weight | 261.745 |
| Exact Mass | 261.113159 |
| PSA | 53.71000 |
| LogP | 3.10440 |
| InChIKey | HAIHNGCKJFYVFH-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)c(CC(C)N)c(OC)c1.Cl |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-(2,4,6-Trimethoxyphenyl)-2-propanamine hydrochloride (1:1) |
| Benzeneethanamine, 2,4,6-trimethoxy-α-methyl-, hydrochloride (1:1) |
| 2,4,6-Trimethoxyamphetamine hydrochloride |