1H-Pyrrole-2,5-dione,1-(2,4,5-trichlorophenyl)- structure
|
Common Name | 1H-Pyrrole-2,5-dione,1-(2,4,5-trichlorophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 31489-22-2 | Molecular Weight | 276.50300 | |
| Density | 1.664g/cm3 | Boiling Point | 420.7ºC at 760mmHg | |
| Molecular Formula | C10H4Cl3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.2ºC | |
| Name | 1-(2,4,5-trichlorophenyl)pyrrole-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.664g/cm3 |
|---|---|
| Boiling Point | 420.7ºC at 760mmHg |
| Molecular Formula | C10H4Cl3NO2 |
| Molecular Weight | 276.50300 |
| Flash Point | 208.2ºC |
| Exact Mass | 274.93100 |
| PSA | 37.38000 |
| LogP | 3.14120 |
| Index of Refraction | 1.655 |
| InChIKey | URZBDQFEBPSHHB-UHFFFAOYSA-N |
| SMILES | O=C1C=CC(=O)N1c1cc(Cl)c(Cl)cc1Cl |
| HS Code | 2925190090 |
|---|
|
~%
1H-Pyrrole-2,5-... CAS#:31489-22-2 |
| Literature: Zhurnal Obshchei Khimii, , vol. 26, p. 208,211 engl.Ausg., , vol. 26, p. 221,223 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| N-(2,4,5-trichloro-phenyl)-maleimide |
| N-(2,4,5-Trichlor-phenyl)-maleinimid |
| 1-(2,4,5-trichloro-phenyl)-pyrrole-2,5-dione |