2-methyl-1H-benz[de]isoquinoline-1,3(2H)-dione structure
|
Common Name | 2-methyl-1H-benz[de]isoquinoline-1,3(2H)-dione | ||
|---|---|---|---|---|
| CAS Number | 2382-08-3 | Molecular Weight | 211.21600 | |
| Density | 1.348g/cm3 | Boiling Point | 380.9ºC at 760mmHg | |
| Molecular Formula | C13H9NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.3ºC | |
| Name | 2-methylbenzo[de]isoquinoline-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.348g/cm3 |
|---|---|
| Boiling Point | 380.9ºC at 760mmHg |
| Molecular Formula | C13H9NO2 |
| Molecular Weight | 211.21600 |
| Flash Point | 181.3ºC |
| Exact Mass | 211.06300 |
| PSA | 39.07000 |
| LogP | 1.48970 |
| Vapour Pressure | 5.28E-06mmHg at 25°C |
| Index of Refraction | 1.694 |
| InChIKey | CZMAEVKITVSOPP-UHFFFAOYSA-N |
| SMILES | CN1C(=O)c2cccc3cccc(c23)C1=O |
| HS Code | 2933990090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-methylnaphthalimide |
| N-methylnaphthalene-1,8-dicarboximide |
| 1-methyl-1,8-naphthalimide |
| N-Methyl-1,8-naphthalimide |
| 2-methyl-1H-benzo[de]isoquinoline-1,3(2H)-dione |
| N-methyl-1,8-naphthalenedicarboximide |